C25H28N2O5 — CID 58001821
3-benzyl-6,7-bis(oxan-3-yloxy)quinazolin-4-one (PubChem CID 58001821) has the molecular formula C25H28N2O5 and a molecular weight of 436.51 g/mol. Its IUPAC name is 3-benzyl-6,7-bis(oxan-3-yloxy)quinazolin-4-one.
| Compound Name | 3-benzyl-6,7-bis(oxan-3-yloxy)quinazolin-4-one |
|---|---|
| PubChem CID | 58001821 |
| Molecular Formula | C25H28N2O5 |
| Molecular Weight | 436.51 g/mol |
| Exact Mass | 436.20 |
| IUPAC Name | 3-benzyl-6,7-bis(oxan-3-yloxy)quinazolin-4-one |
| SMILES | O=c1c2cc(OC3CCCOC3)c(OC3CCCOC3)cc2ncn1Cc1ccccc1 |
| InChI | InChI=1S/C25H28N2O5/c28-25-21-12-23(31-19-8-4-10-29-15-19)24(32-20-9-5-11-30-16-20)13-22(21)26-17-27(25)14-18-6-2-1-3-7-18/h1-3,6-7,12-13,17,19-20H,4-5,8-11,14-16H2 |
| InChIKey | QUSLRTQRAPHUNO-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 71.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.51 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |