C20H30ClN3O4 — CID 58002083
tert-butyl N-[[4-[[(2-chloro-6-methoxypyridine-4-carbonyl)amino]methyl]cyclohexyl]methyl]carbamate (PubChem CID 58002083) has the molecular formula C20H30ClN3O4 and a molecular weight of 411.93 g/mol. Its IUPAC name is tert-butyl N-[[4-[[(2-chloro-6-methoxypyridine-4-carbonyl)amino]methyl]cyclohexyl]methyl]carbamate.
| Compound Name | tert-butyl N-[[4-[[(2-chloro-6-methoxypyridine-4-carbonyl)amino]methyl]cyclohexyl]methyl]carbamate |
|---|---|
| PubChem CID | 58002083 |
| Molecular Formula | C20H30ClN3O4 |
| Molecular Weight | 411.93 g/mol |
| Exact Mass | 411.19 |
| IUPAC Name | tert-butyl N-[[4-[[(2-chloro-6-methoxypyridine-4-carbonyl)amino]methyl]cyclohexyl]methyl]carbamate |
| SMILES | COc1cc(C(=O)NCC2CCC(CNC(=O)OC(C)(C)C)CC2)cc(Cl)n1 |
| InChI | InChI=1S/C20H30ClN3O4/c1-20(2,3)28-19(26)23-12-14-7-5-13(6-8-14)11-22-18(25)15-9-16(21)24-17(10-15)27-4/h9-10,13-14H,5-8,11-12H2,1-4H3,(H,22,25)(H,23,26) |
| InChIKey | DIWOEDVMNVVQNE-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 89.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.93 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|