C21H16F3N3OPt — CID 58004407
methyl-[2-methyl-2-[6-(2,3,4-trifluoro-5-pyridin-2-ylbenzene-6-id-1-yl)-2-pyridinyl]propanoyl]azanide;platinum(2+) (PubChem CID 58004407) has the molecular formula C21H16F3N3OPt and a molecular weight of 578.45 g/mol. Its IUPAC name is methyl-[2-methyl-2-[6-(2,3,4-trifluoro-5-pyridin-2-ylbenzene-6-id-1-yl)-2-pyridinyl]propanoyl]azanide;platinum(2+).
| Compound Name | methyl-[2-methyl-2-[6-(2,3,4-trifluoro-5-pyridin-2-ylbenzene-6-id-1-yl)-2-pyridinyl]propanoyl]azanide;platinum(2+) |
|---|---|
| PubChem CID | 58004407 |
| Molecular Formula | C21H16F3N3OPt |
| Molecular Weight | 578.45 g/mol |
| Exact Mass | 578.09 |
| IUPAC Name | methyl-[2-methyl-2-[6-(2,3,4-trifluoro-5-pyridin-2-ylbenzene-6-id-1-yl)-2-pyridinyl]propanoyl]azanide;platinum(2+) |
| SMILES | C[N-]C(=O)C(C)(C)c1cccc(-c2[c-]c(-c3ccccn3)c(F)c(F)c2F)n1.[Pt+2] |
| InChI | InChI=1S/C21H17F3N3O.Pt/c1-21(2,20(28)25-3)16-9-6-8-15(27-16)13-11-12(14-7-4-5-10-26-14)17(22)19(24)18(13)23;/h4-10H,1-3H3,(H,25,28);/q-1;+2/p-1 |
| InChIKey | MBVKVBRMRXEORM-UHFFFAOYSA-M |
| XLogP | 4.83 |
| TPSA | 56.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.45 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|