C19H16O2 — CID 58005185
1-methoxy-4-[1-(4-methoxyphenyl)penta-1,4-diyn-3-yl]benzene (PubChem CID 58005185) has the molecular formula C19H16O2 and a molecular weight of 276.33 g/mol. Its IUPAC name is 1-methoxy-4-[1-(4-methoxyphenyl)penta-1,4-diyn-3-yl]benzene.
| Compound Name | 1-methoxy-4-[1-(4-methoxyphenyl)penta-1,4-diyn-3-yl]benzene |
|---|---|
| PubChem CID | 58005185 |
| Molecular Formula | C19H16O2 |
| Molecular Weight | 276.33 g/mol |
| Exact Mass | 276.12 |
| IUPAC Name | 1-methoxy-4-[1-(4-methoxyphenyl)penta-1,4-diyn-3-yl]benzene |
| SMILES | C#CC(C#Cc1ccc(OC)cc1)c1ccc(OC)cc1 |
| InChI | InChI=1S/C19H16O2/c1-4-16(17-9-13-19(21-3)14-10-17)8-5-15-6-11-18(20-2)12-7-15/h1,6-7,9-14,16H,2-3H3 |
| InChIKey | YKQHCHYDNWDHFZ-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.33 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|