C14H20BNO5 — CID 58005626
methyl 2-[[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinyl]oxy]acetate (PubChem CID 58005626) has the molecular formula C14H20BNO5 and a molecular weight of 293.13 g/mol. Its IUPAC name is methyl 2-[[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinyl]oxy]acetate.
| Compound Name | methyl 2-[[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinyl]oxy]acetate |
|---|---|
| PubChem CID | 58005626 |
| Molecular Formula | C14H20BNO5 |
| Molecular Weight | 293.13 g/mol |
| Exact Mass | 293.14 |
| IUPAC Name | methyl 2-[[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinyl]oxy]acetate |
| SMILES | COC(=O)COc1ccc(B2OC(C)(C)C(C)(C)O2)cn1 |
| InChI | InChI=1S/C14H20BNO5/c1-13(2)14(3,4)21-15(20-13)10-6-7-11(16-8-10)19-9-12(17)18-5/h6-8H,9H2,1-5H3 |
| InChIKey | QMSMRWQJDYUHEC-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 66.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.13 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|