C31H36Cl2N4O2S — CID 58006972
(2S,5R)-1-[(5R,6S)-5,6-bis(4-chlorophenyl)-6-methyl-3-propan-2-yl-5H-imidazo[2,1-b][1,3]thiazole-2-carbonyl]-5-ethyl-N,N-dimethylpyrrolidine-2-carboxamide (PubChem CID 58006972) has the molecular formula C31H36Cl2N4O2S and a molecular weight of 599.63 g/mol. Its IUPAC name is (2S,5R)-1-[(5R,6S)-5,6-bis(4-chlorophenyl)-6-methyl-3-propan-2-yl-5H-imidazo[2,1-b][1,3]thiazole-2-carbonyl]-5-ethyl-N,N-dimethylpyrrolidine-2-carboxamide.
| Compound Name | (2S,5R)-1-[(5R,6S)-5,6-bis(4-chlorophenyl)-6-methyl-3-propan-2-yl-5H-imidazo[2,1-b][1,3]thiazole-2-carbonyl]-5-ethyl-N,N-dimethylpyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 58006972 |
| Molecular Formula | C31H36Cl2N4O2S |
| Molecular Weight | 599.63 g/mol |
| Exact Mass | 598.19 |
| IUPAC Name | (2S,5R)-1-[(5R,6S)-5,6-bis(4-chlorophenyl)-6-methyl-3-propan-2-yl-5H-imidazo[2,1-b][1,3]thiazole-2-carbonyl]-5-ethyl-N,N-dimethylpyrrolidine-2-carboxamide |
| SMILES | CC[C@@H]1CC[C@@H](C(=O)N(C)C)N1C(=O)C1=C(C(C)C)N2C(=N[C@@](C)(c3ccc(Cl)cc3)[C@H]2c2ccc(Cl)cc2)S1 |
| InChI | InChI=1S/C31H36Cl2N4O2S/c1-7-23-16-17-24(28(38)35(5)6)36(23)29(39)26-25(18(2)3)37-27(19-8-12-21(32)13-9-19)31(4,34-30(37)40-26)20-10-14-22(33)15-11-20/h8-15,18,23-24,27H,7,16-17H2,1-6H3/t23-,24+,27-,31+/m1/s1 |
| InChIKey | KXWDKMJGUISCJZ-LVISKLAHSA-N |
| XLogP | 7.09 |
| TPSA | 56.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.63 |
| LogP ≤ 5 | 7.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |