C25H24Cl2N4O2S — CID 58007477
4-[(5R,6S)-5,6-bis(4-chlorophenyl)-3-propan-2-yl-5,6-dihydroimidazo[2,1-b][1,3]thiazole-2-carbonyl]piperazin-2-one (PubChem CID 58007477) has the molecular formula C25H24Cl2N4O2S and a molecular weight of 515.47 g/mol. Its IUPAC name is 4-[(5R,6S)-5,6-bis(4-chlorophenyl)-3-propan-2-yl-5,6-dihydroimidazo[2,1-b][1,3]thiazole-2-carbonyl]piperazin-2-one.
| Compound Name | 4-[(5R,6S)-5,6-bis(4-chlorophenyl)-3-propan-2-yl-5,6-dihydroimidazo[2,1-b][1,3]thiazole-2-carbonyl]piperazin-2-one |
|---|---|
| PubChem CID | 58007477 |
| Molecular Formula | C25H24Cl2N4O2S |
| Molecular Weight | 515.47 g/mol |
| Exact Mass | 514.10 |
| IUPAC Name | 4-[(5R,6S)-5,6-bis(4-chlorophenyl)-3-propan-2-yl-5,6-dihydroimidazo[2,1-b][1,3]thiazole-2-carbonyl]piperazin-2-one |
| SMILES | CC(C)C1=C(C(=O)N2CCNC(=O)C2)SC2=N[C@@H](c3ccc(Cl)cc3)[C@@H](c3ccc(Cl)cc3)N21 |
| InChI | InChI=1S/C25H24Cl2N4O2S/c1-14(2)21-23(24(33)30-12-11-28-19(32)13-30)34-25-29-20(15-3-7-17(26)8-4-15)22(31(21)25)16-5-9-18(27)10-6-16/h3-10,14,20,22H,11-13H2,1-2H3,(H,28,32)/t20-,22+/m0/s1 |
| InChIKey | LNDPUCKALGGUTH-RBBKRZOGSA-N |
| XLogP | 5.02 |
| TPSA | 65.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.47 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |