C23H37NO6S — CID 58011561
tert-butyl 2,2-dimethyl-4-[2-[(4-methylphenyl)sulfonyloxymethyl]pentyl]-1,3-oxazolidine-3-carboxylate (PubChem CID 58011561) has the molecular formula C23H37NO6S and a molecular weight of 455.62 g/mol. Its IUPAC name is tert-butyl 2,2-dimethyl-4-[2-[(4-methylphenyl)sulfonyloxymethyl]pentyl]-1,3-oxazolidine-3-carboxylate.
| Compound Name | tert-butyl 2,2-dimethyl-4-[2-[(4-methylphenyl)sulfonyloxymethyl]pentyl]-1,3-oxazolidine-3-carboxylate |
|---|---|
| PubChem CID | 58011561 |
| Molecular Formula | C23H37NO6S |
| Molecular Weight | 455.62 g/mol |
| Exact Mass | 455.23 |
| IUPAC Name | tert-butyl 2,2-dimethyl-4-[2-[(4-methylphenyl)sulfonyloxymethyl]pentyl]-1,3-oxazolidine-3-carboxylate |
| SMILES | CCCC(COS(=O)(=O)c1ccc(C)cc1)CC1COC(C)(C)N1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C23H37NO6S/c1-8-9-18(15-29-31(26,27)20-12-10-17(2)11-13-20)14-19-16-28-23(6,7)24(19)21(25)30-22(3,4)5/h10-13,18-19H,8-9,14-16H2,1-7H3 |
| InChIKey | PHASBQAXLIBGIL-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.62 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|