C17H26O7 — CID 58013657
[(2S,3R,4R,5S,6R)-2-ethynyl-3,5-dihydroxy-6-pentanoyloxyoxan-4-yl] pentanoate (PubChem CID 58013657) has the molecular formula C17H26O7 and a molecular weight of 342.39 g/mol. Its IUPAC name is [(2S,3R,4R,5S,6R)-2-ethynyl-3,5-dihydroxy-6-pentanoyloxyoxan-4-yl] pentanoate.
| Compound Name | [(2S,3R,4R,5S,6R)-2-ethynyl-3,5-dihydroxy-6-pentanoyloxyoxan-4-yl] pentanoate |
|---|---|
| PubChem CID | 58013657 |
| Molecular Formula | C17H26O7 |
| Molecular Weight | 342.39 g/mol |
| Exact Mass | 342.17 |
| IUPAC Name | [(2S,3R,4R,5S,6R)-2-ethynyl-3,5-dihydroxy-6-pentanoyloxyoxan-4-yl] pentanoate |
| SMILES | C#C[C@@H]1O[C@H](OC(=O)CCCC)[C@@H](O)[C@H](OC(=O)CCCC)[C@@H]1O |
| InChI | InChI=1S/C17H26O7/c1-4-7-9-12(18)23-16-14(20)11(6-3)22-17(15(16)21)24-13(19)10-8-5-2/h3,11,14-17,20-21H,4-5,7-10H2,1-2H3/t11-,14+,15-,16+,17+/m0/s1 |
| InChIKey | HGVJZMVNEDNOQF-FEMNKSEZSA-N |
| XLogP | 0.90 |
| TPSA | 102.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.39 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|