C17H26O6 — CID 139473454
[(2R,3S,4R)-6-ethynyl-3-hydroxy-2-pentanoyloxyoxan-4-yl] pentanoate (PubChem CID 139473454) has the molecular formula C17H26O6 and a molecular weight of 326.39 g/mol. Its IUPAC name is [(2R,3S,4R)-6-ethynyl-3-hydroxy-2-pentanoyloxyoxan-4-yl] pentanoate.
| Compound Name | [(2R,3S,4R)-6-ethynyl-3-hydroxy-2-pentanoyloxyoxan-4-yl] pentanoate |
|---|---|
| PubChem CID | 139473454 |
| Molecular Formula | C17H26O6 |
| Molecular Weight | 326.39 g/mol |
| Exact Mass | 326.17 |
| IUPAC Name | [(2R,3S,4R)-6-ethynyl-3-hydroxy-2-pentanoyloxyoxan-4-yl] pentanoate |
| SMILES | C#CC1C[C@@H](OC(=O)CCCC)[C@H](O)[C@@H](OC(=O)CCCC)O1 |
| InChI | InChI=1S/C17H26O6/c1-4-7-9-14(18)22-13-11-12(6-3)21-17(16(13)20)23-15(19)10-8-5-2/h3,12-13,16-17,20H,4-5,7-11H2,1-2H3/t12?,13-,16+,17-/m1/s1 |
| InChIKey | QPFFNHFRVGZIIY-LAPMDVQOSA-N |
| XLogP | 1.93 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.39 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|