C11H19NOS — CID 58017970
2,5-dimethyl-4-(3-propoxypropyl)-1,3-thiazole (PubChem CID 58017970) has the molecular formula C11H19NOS and a molecular weight of 213.35 g/mol. Its IUPAC name is 2,5-dimethyl-4-(3-propoxypropyl)-1,3-thiazole.
| Compound Name | 2,5-dimethyl-4-(3-propoxypropyl)-1,3-thiazole |
|---|---|
| PubChem CID | 58017970 |
| Molecular Formula | C11H19NOS |
| Molecular Weight | 213.35 g/mol |
| Exact Mass | 213.12 |
| IUPAC Name | 2,5-dimethyl-4-(3-propoxypropyl)-1,3-thiazole |
| SMILES | CCCOCCCc1nc(C)sc1C |
| InChI | InChI=1S/C11H19NOS/c1-4-7-13-8-5-6-11-9(2)14-10(3)12-11/h4-8H2,1-3H3 |
| InChIKey | BFWZNGPPVUKFSG-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.35 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|