C20H17ClFNO2 — CID 58019920
[5-[[3-(3-chlorophenyl)-2-fluoro-4-methoxyphenyl]methyl]-2-pyridinyl]methanol (PubChem CID 58019920) has the molecular formula C20H17ClFNO2 and a molecular weight of 357.81 g/mol. Its IUPAC name is [5-[[3-(3-chlorophenyl)-2-fluoro-4-methoxyphenyl]methyl]-2-pyridinyl]methanol.
| Compound Name | [5-[[3-(3-chlorophenyl)-2-fluoro-4-methoxyphenyl]methyl]-2-pyridinyl]methanol |
|---|---|
| PubChem CID | 58019920 |
| Molecular Formula | C20H17ClFNO2 |
| Molecular Weight | 357.81 g/mol |
| Exact Mass | 357.09 |
| IUPAC Name | [5-[[3-(3-chlorophenyl)-2-fluoro-4-methoxyphenyl]methyl]-2-pyridinyl]methanol |
| SMILES | COc1ccc(Cc2ccc(CO)nc2)c(F)c1-c1cccc(Cl)c1 |
| InChI | InChI=1S/C20H17ClFNO2/c1-25-18-8-6-15(9-13-5-7-17(12-24)23-11-13)20(22)19(18)14-3-2-4-16(21)10-14/h2-8,10-11,24H,9,12H2,1H3 |
| InChIKey | WYQBUKDUFJQJGB-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 42.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.81 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |