C27H19N5O7 — CID 58020450
2-nitro-N-[4-[5-[(2-nitrobenzoyl)amino]-2,3-dihydro-1,3-benzoxazol-2-yl]phenyl]benzamide (PubChem CID 58020450) has the molecular formula C27H19N5O7 and a molecular weight of 525.48 g/mol. Its IUPAC name is 2-nitro-N-[4-[5-[(2-nitrobenzoyl)amino]-2,3-dihydro-1,3-benzoxazol-2-yl]phenyl]benzamide.
| Compound Name | 2-nitro-N-[4-[5-[(2-nitrobenzoyl)amino]-2,3-dihydro-1,3-benzoxazol-2-yl]phenyl]benzamide |
|---|---|
| PubChem CID | 58020450 |
| Molecular Formula | C27H19N5O7 |
| Molecular Weight | 525.48 g/mol |
| Exact Mass | 525.13 |
| IUPAC Name | 2-nitro-N-[4-[5-[(2-nitrobenzoyl)amino]-2,3-dihydro-1,3-benzoxazol-2-yl]phenyl]benzamide |
| SMILES | O=C(Nc1ccc(C2Nc3cc(NC(=O)c4ccccc4[N+](=O)[O-])ccc3O2)cc1)c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C27H19N5O7/c33-25(19-5-1-3-7-22(19)31(35)36)28-17-11-9-16(10-12-17)27-30-21-15-18(13-14-24(21)39-27)29-26(34)20-6-2-4-8-23(20)32(37)38/h1-15,27,30H,(H,28,33)(H,29,34) |
| InChIKey | YOKARDZXSDIRJV-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 165.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.48 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|