C18H20ClF3NO4PS — CID 58022564
[(2R)-2-amino-4-[2-chloro-4-[3-(trifluoromethyl)phenyl]sulfanylphenyl]-2-methylbutyl] dihydrogen phosphate (PubChem CID 58022564) has the molecular formula C18H20ClF3NO4PS and a molecular weight of 469.85 g/mol. Its IUPAC name is [(2R)-2-amino-4-[2-chloro-4-[3-(trifluoromethyl)phenyl]sulfanylphenyl]-2-methylbutyl] dihydrogen phosphate.
| Compound Name | [(2R)-2-amino-4-[2-chloro-4-[3-(trifluoromethyl)phenyl]sulfanylphenyl]-2-methylbutyl] dihydrogen phosphate |
|---|---|
| PubChem CID | 58022564 |
| Molecular Formula | C18H20ClF3NO4PS |
| Molecular Weight | 469.85 g/mol |
| Exact Mass | 469.05 |
| IUPAC Name | [(2R)-2-amino-4-[2-chloro-4-[3-(trifluoromethyl)phenyl]sulfanylphenyl]-2-methylbutyl] dihydrogen phosphate |
| SMILES | C[C@@](N)(CCc1ccc(Sc2cccc(C(F)(F)F)c2)cc1Cl)COP(=O)(O)O |
| InChI | InChI=1S/C18H20ClF3NO4PS/c1-17(23,11-27-28(24,25)26)8-7-12-5-6-15(10-16(12)19)29-14-4-2-3-13(9-14)18(20,21)22/h2-6,9-10H,7-8,11,23H2,1H3,(H2,24,25,26)/t17-/m1/s1 |
| InChIKey | GUGQAAUCEGBIOI-QGZVFWFLSA-N |
| XLogP | 5.27 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.85 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|