C18H20ClF3NO3PS — CID 24890323
[(2R)-2-amino-4-[2-chloro-4-[3-(trifluoromethyl)phenyl]sulfanylphenyl]-2-methylbutyl]phosphonic acid (PubChem CID 24890323) has the molecular formula C18H20ClF3NO3PS and a molecular weight of 453.85 g/mol. Its IUPAC name is [(2R)-2-amino-4-[2-chloro-4-[3-(trifluoromethyl)phenyl]sulfanylphenyl]-2-methylbutyl]phosphonic acid.
| Compound Name | [(2R)-2-amino-4-[2-chloro-4-[3-(trifluoromethyl)phenyl]sulfanylphenyl]-2-methylbutyl]phosphonic acid |
|---|---|
| PubChem CID | 24890323 |
| Molecular Formula | C18H20ClF3NO3PS |
| Molecular Weight | 453.85 g/mol |
| Exact Mass | 453.05 |
| IUPAC Name | [(2R)-2-amino-4-[2-chloro-4-[3-(trifluoromethyl)phenyl]sulfanylphenyl]-2-methylbutyl]phosphonic acid |
| SMILES | C[C@@](N)(CCc1ccc(Sc2cccc(C(F)(F)F)c2)cc1Cl)CP(=O)(O)O |
| InChI | InChI=1S/C18H20ClF3NO3PS/c1-17(23,11-27(24,25)26)8-7-12-5-6-15(10-16(12)19)28-14-4-2-3-13(9-14)18(20,21)22/h2-6,9-10H,7-8,11,23H2,1H3,(H2,24,25,26)/t17-/m1/s1 |
| InChIKey | FKZMFPPSMMVXRY-QGZVFWFLSA-N |
| XLogP | 5.34 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.85 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|