C19H23ClF2NO4PS — CID 58022593
[(2R)-2-amino-5-[2-chloro-4-[3-(difluoromethyl)phenyl]sulfanylphenyl]-2-methylpentyl] dihydrogen phosphate (PubChem CID 58022593) has the molecular formula C19H23ClF2NO4PS and a molecular weight of 465.89 g/mol. Its IUPAC name is [(2R)-2-amino-5-[2-chloro-4-[3-(difluoromethyl)phenyl]sulfanylphenyl]-2-methylpentyl] dihydrogen phosphate.
| Compound Name | [(2R)-2-amino-5-[2-chloro-4-[3-(difluoromethyl)phenyl]sulfanylphenyl]-2-methylpentyl] dihydrogen phosphate |
|---|---|
| PubChem CID | 58022593 |
| Molecular Formula | C19H23ClF2NO4PS |
| Molecular Weight | 465.89 g/mol |
| Exact Mass | 465.07 |
| IUPAC Name | [(2R)-2-amino-5-[2-chloro-4-[3-(difluoromethyl)phenyl]sulfanylphenyl]-2-methylpentyl] dihydrogen phosphate |
| SMILES | C[C@@](N)(CCCc1ccc(Sc2cccc(C(F)F)c2)cc1Cl)COP(=O)(O)O |
| InChI | InChI=1S/C19H23ClF2NO4PS/c1-19(23,12-27-28(24,25)26)9-3-5-13-7-8-16(11-17(13)20)29-15-6-2-4-14(10-15)18(21)22/h2,4,6-8,10-11,18H,3,5,9,12,23H2,1H3,(H2,24,25,26)/t19-/m1/s1 |
| InChIKey | LJLQGCYSWAAOLC-LJQANCHMSA-N |
| XLogP | 5.58 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.89 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|