C19H22ClF3NO5PS — CID 59837300
[2-amino-5-[2-chloro-4-[3-(trifluoromethyl)phenyl]sulfanylphenyl]-2-(hydroxymethyl)pentyl] dihydrogen phosphate (PubChem CID 59837300) has the molecular formula C19H22ClF3NO5PS and a molecular weight of 499.88 g/mol. Its IUPAC name is [2-amino-5-[2-chloro-4-[3-(trifluoromethyl)phenyl]sulfanylphenyl]-2-(hydroxymethyl)pentyl] dihydrogen phosphate.
| Compound Name | [2-amino-5-[2-chloro-4-[3-(trifluoromethyl)phenyl]sulfanylphenyl]-2-(hydroxymethyl)pentyl] dihydrogen phosphate |
|---|---|
| PubChem CID | 59837300 |
| Molecular Formula | C19H22ClF3NO5PS |
| Molecular Weight | 499.88 g/mol |
| Exact Mass | 499.06 |
| IUPAC Name | [2-amino-5-[2-chloro-4-[3-(trifluoromethyl)phenyl]sulfanylphenyl]-2-(hydroxymethyl)pentyl] dihydrogen phosphate |
| SMILES | NC(CO)(CCCc1ccc(Sc2cccc(C(F)(F)F)c2)cc1Cl)COP(=O)(O)O |
| InChI | InChI=1S/C19H22ClF3NO5PS/c20-17-10-16(31-15-5-1-4-14(9-15)19(21,22)23)7-6-13(17)3-2-8-18(24,11-25)12-29-30(26,27)28/h1,4-7,9-10,25H,2-3,8,11-12,24H2,(H2,26,27,28) |
| InChIKey | SUZMGLOYOFQNGW-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 113.01 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.88 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|