C22H21N4O2+ — CID 58023663
N-[2-(2-methoxyphenyl)ethyl]-1-pyridin-4-yl-2H-imidazo[1,5-a]pyridin-4-ium-3-carboxamide (PubChem CID 58023663) has the molecular formula C22H21N4O2+ and a molecular weight of 373.44 g/mol. Its IUPAC name is N-[2-(2-methoxyphenyl)ethyl]-1-pyridin-4-yl-2H-imidazo[1,5-a]pyridin-4-ium-3-carboxamide.
| Compound Name | N-[2-(2-methoxyphenyl)ethyl]-1-pyridin-4-yl-2H-imidazo[1,5-a]pyridin-4-ium-3-carboxamide |
|---|---|
| PubChem CID | 58023663 |
| Molecular Formula | C22H21N4O2+ |
| Molecular Weight | 373.44 g/mol |
| Exact Mass | 373.17 |
| IUPAC Name | N-[2-(2-methoxyphenyl)ethyl]-1-pyridin-4-yl-2H-imidazo[1,5-a]pyridin-4-ium-3-carboxamide |
| SMILES | COc1ccccc1CCNC(=O)c1[nH]c(-c2ccncc2)c2cccc[n+]12 |
| InChI | InChI=1S/C22H20N4O2/c1-28-19-8-3-2-6-16(19)11-14-24-22(27)21-25-20(17-9-12-23-13-10-17)18-7-4-5-15-26(18)21/h2-10,12-13,15H,11,14H2,1H3,(H,24,27)/p+1 |
| InChIKey | UYDBNHWJGXMNJR-UHFFFAOYSA-O |
| XLogP | 2.80 |
| TPSA | 71.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.44 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|