C21H20N4O+2 — CID 58023881
N-(2-phenylethyl)-1-pyridin-1-ium-4-yl-2H-imidazo[1,5-a]pyridin-4-ium-3-carboxamide (PubChem CID 58023881) has the molecular formula C21H20N4O+2 and a molecular weight of 344.42 g/mol. Its IUPAC name is N-(2-phenylethyl)-1-pyridin-1-ium-4-yl-2H-imidazo[1,5-a]pyridin-4-ium-3-carboxamide.
| Compound Name | N-(2-phenylethyl)-1-pyridin-1-ium-4-yl-2H-imidazo[1,5-a]pyridin-4-ium-3-carboxamide |
|---|---|
| PubChem CID | 58023881 |
| Molecular Formula | C21H20N4O+2 |
| Molecular Weight | 344.42 g/mol |
| Exact Mass | 344.16 |
| IUPAC Name | N-(2-phenylethyl)-1-pyridin-1-ium-4-yl-2H-imidazo[1,5-a]pyridin-4-ium-3-carboxamide |
| SMILES | O=C(NCCc1ccccc1)c1[nH]c(-c2cc[nH+]cc2)c2cccc[n+]12 |
| InChI | InChI=1S/C21H18N4O/c26-21(23-14-9-16-6-2-1-3-7-16)20-24-19(17-10-12-22-13-11-17)18-8-4-5-15-25(18)20/h1-8,10-13,15H,9,14H2,(H,23,26)/p+2 |
| InChIKey | HNXPWGQKUXKXIQ-UHFFFAOYSA-P |
| XLogP | 2.21 |
| TPSA | 63.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.42 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|