C19H16N5O+ — CID 58023982
N-pyridin-3-yl-3-(pyridin-3-ylmethyl)-2H-imidazo[1,5-a]pyridin-4-ium-1-carboxamide (PubChem CID 58023982) has the molecular formula C19H16N5O+ and a molecular weight of 330.37 g/mol. Its IUPAC name is N-pyridin-3-yl-3-(pyridin-3-ylmethyl)-2H-imidazo[1,5-a]pyridin-4-ium-1-carboxamide.
| Compound Name | N-pyridin-3-yl-3-(pyridin-3-ylmethyl)-2H-imidazo[1,5-a]pyridin-4-ium-1-carboxamide |
|---|---|
| PubChem CID | 58023982 |
| Molecular Formula | C19H16N5O+ |
| Molecular Weight | 330.37 g/mol |
| Exact Mass | 330.13 |
| IUPAC Name | N-pyridin-3-yl-3-(pyridin-3-ylmethyl)-2H-imidazo[1,5-a]pyridin-4-ium-1-carboxamide |
| SMILES | O=C(Nc1cccnc1)c1[nH]c(Cc2cccnc2)[n+]2ccccc12 |
| InChI | InChI=1S/C19H15N5O/c25-19(22-15-6-4-9-21-13-15)18-16-7-1-2-10-24(16)17(23-18)11-14-5-3-8-20-12-14/h1-10,12-13H,11H2,(H,22,25)/p+1 |
| InChIKey | LDBOSIDQTDUGGR-UHFFFAOYSA-O |
| XLogP | 2.39 |
| TPSA | 74.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.37 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|