C21H26N2O4 — CID 58024538
4-hydroxy-2-oxo-N-(4-piperidin-1-ylphenyl)-4a,5,6,7,8,8a-hexahydrochromene-3-carboxamide (PubChem CID 58024538) has the molecular formula C21H26N2O4 and a molecular weight of 370.45 g/mol. Its IUPAC name is 4-hydroxy-2-oxo-N-(4-piperidin-1-ylphenyl)-4a,5,6,7,8,8a-hexahydrochromene-3-carboxamide.
| Compound Name | 4-hydroxy-2-oxo-N-(4-piperidin-1-ylphenyl)-4a,5,6,7,8,8a-hexahydrochromene-3-carboxamide |
|---|---|
| PubChem CID | 58024538 |
| Molecular Formula | C21H26N2O4 |
| Molecular Weight | 370.45 g/mol |
| Exact Mass | 370.19 |
| IUPAC Name | 4-hydroxy-2-oxo-N-(4-piperidin-1-ylphenyl)-4a,5,6,7,8,8a-hexahydrochromene-3-carboxamide |
| SMILES | O=C(Nc1ccc(N2CCCCC2)cc1)C1=C(O)C2CCCCC2OC1=O |
| InChI | InChI=1S/C21H26N2O4/c24-19-16-6-2-3-7-17(16)27-21(26)18(19)20(25)22-14-8-10-15(11-9-14)23-12-4-1-5-13-23/h8-11,16-17,24H,1-7,12-13H2,(H,22,25) |
| InChIKey | OCCVXMHDEGUCQM-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.45 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|