C22H30N4O3 — CID 58024653
(4aS,8aS)-6-ethyl-4-hydroxy-2-oxo-N-(4-piperidin-1-ylphenyl)-1,4a,5,7,8,8a-hexahydro-1,6-naphthyridine-3-carboxamide (PubChem CID 58024653) has the molecular formula C22H30N4O3 and a molecular weight of 398.51 g/mol. Its IUPAC name is (4aS,8aS)-6-ethyl-4-hydroxy-2-oxo-N-(4-piperidin-1-ylphenyl)-1,4a,5,7,8,8a-hexahydro-1,6-naphthyridine-3-carboxamide.
| Compound Name | (4aS,8aS)-6-ethyl-4-hydroxy-2-oxo-N-(4-piperidin-1-ylphenyl)-1,4a,5,7,8,8a-hexahydro-1,6-naphthyridine-3-carboxamide |
|---|---|
| PubChem CID | 58024653 |
| Molecular Formula | C22H30N4O3 |
| Molecular Weight | 398.51 g/mol |
| Exact Mass | 398.23 |
| IUPAC Name | (4aS,8aS)-6-ethyl-4-hydroxy-2-oxo-N-(4-piperidin-1-ylphenyl)-1,4a,5,7,8,8a-hexahydro-1,6-naphthyridine-3-carboxamide |
| SMILES | CCN1CC[C@@H]2NC(=O)C(C(=O)Nc3ccc(N4CCCCC4)cc3)=C(O)[C@H]2C1 |
| InChI | InChI=1S/C22H30N4O3/c1-2-25-13-10-18-17(14-25)20(27)19(22(29)24-18)21(28)23-15-6-8-16(9-7-15)26-11-4-3-5-12-26/h6-9,17-18,27H,2-5,10-14H2,1H3,(H,23,28)(H,24,29)/t17-,18-/m0/s1 |
| InChIKey | LUSUVDINLBJMCC-ROUUACIJSA-N |
| XLogP | 2.27 |
| TPSA | 84.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.51 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|