C21H21N3O3 — CID 58024589
N-(4-cyclohexylphenyl)-4-hydroxy-2-oxo-1H-1,5-naphthyridine-3-carboxamide (PubChem CID 58024589) has the molecular formula C21H21N3O3 and a molecular weight of 363.42 g/mol. Its IUPAC name is N-(4-cyclohexylphenyl)-4-hydroxy-2-oxo-1H-1,5-naphthyridine-3-carboxamide.
| Compound Name | N-(4-cyclohexylphenyl)-4-hydroxy-2-oxo-1H-1,5-naphthyridine-3-carboxamide |
|---|---|
| PubChem CID | 58024589 |
| Molecular Formula | C21H21N3O3 |
| Molecular Weight | 363.42 g/mol |
| Exact Mass | 363.16 |
| IUPAC Name | N-(4-cyclohexylphenyl)-4-hydroxy-2-oxo-1H-1,5-naphthyridine-3-carboxamide |
| SMILES | O=C(Nc1ccc(C2CCCCC2)cc1)c1c(O)c2ncccc2[nH]c1=O |
| InChI | InChI=1S/C21H21N3O3/c25-19-17(21(27)24-16-7-4-12-22-18(16)19)20(26)23-15-10-8-14(9-11-15)13-5-2-1-3-6-13/h4,7-13H,1-3,5-6H2,(H,23,26)(H2,24,25,27) |
| InChIKey | DVBQNANVQJAVNB-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 95.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.42 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |