C23H21FN2O — CID 58639613
N-(4-cyclopentylphenyl)-4-(3-fluoro-2-pyridinyl)benzamide (PubChem CID 58639613) has the molecular formula C23H21FN2O and a molecular weight of 360.43 g/mol. Its IUPAC name is N-(4-cyclopentylphenyl)-4-(3-fluoro-2-pyridinyl)benzamide.
| Compound Name | N-(4-cyclopentylphenyl)-4-(3-fluoro-2-pyridinyl)benzamide |
|---|---|
| PubChem CID | 58639613 |
| Molecular Formula | C23H21FN2O |
| Molecular Weight | 360.43 g/mol |
| Exact Mass | 360.16 |
| IUPAC Name | N-(4-cyclopentylphenyl)-4-(3-fluoro-2-pyridinyl)benzamide |
| SMILES | O=C(Nc1ccc(C2CCCC2)cc1)c1ccc(-c2ncccc2F)cc1 |
| InChI | InChI=1S/C23H21FN2O/c24-21-6-3-15-25-22(21)18-7-9-19(10-8-18)23(27)26-20-13-11-17(12-14-20)16-4-1-2-5-16/h3,6-16H,1-2,4-5H2,(H,26,27) |
| InChIKey | AQYCNWFIUAUSFH-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.43 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |