C31H43BrN6O3 — CID 58024751
4-(8-bromooctanoylamino)-N-[[1,6-diethyl-4-(oxan-4-ylamino)pyrazolo[3,4-b]pyridin-5-yl]methyl]benzamide (PubChem CID 58024751) has the molecular formula C31H43BrN6O3 and a molecular weight of 627.63 g/mol. Its IUPAC name is 4-(8-bromooctanoylamino)-N-[[1,6-diethyl-4-(oxan-4-ylamino)pyrazolo[3,4-b]pyridin-5-yl]methyl]benzamide.
| Compound Name | 4-(8-bromooctanoylamino)-N-[[1,6-diethyl-4-(oxan-4-ylamino)pyrazolo[3,4-b]pyridin-5-yl]methyl]benzamide |
|---|---|
| PubChem CID | 58024751 |
| Molecular Formula | C31H43BrN6O3 |
| Molecular Weight | 627.63 g/mol |
| Exact Mass | 626.26 |
| IUPAC Name | 4-(8-bromooctanoylamino)-N-[[1,6-diethyl-4-(oxan-4-ylamino)pyrazolo[3,4-b]pyridin-5-yl]methyl]benzamide |
| SMILES | CCc1nc2c(cnn2CC)c(NC2CCOCC2)c1CNC(=O)c1ccc(NC(=O)CCCCCCCBr)cc1 |
| InChI | InChI=1S/C31H43BrN6O3/c1-3-27-25(29(36-24-15-18-41-19-16-24)26-21-34-38(4-2)30(26)37-27)20-33-31(40)22-11-13-23(14-12-22)35-28(39)10-8-6-5-7-9-17-32/h11-14,21,24H,3-10,15-20H2,1-2H3,(H,33,40)(H,35,39)(H,36,37) |
| InChIKey | LMDQCVCYHFORRH-UHFFFAOYSA-N |
| XLogP | 6.21 |
| TPSA | 110.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.63 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|