C28H36BFN6O3 — CID 89164450
CID 89164450 (PubChem CID 89164450) has the molecular formula C28H36BFN6O3 and a molecular weight of 534.45 g/mol.
| Compound Name | CID 89164450 |
|---|---|
| PubChem CID | 89164450 |
| Molecular Formula | C28H36BFN6O3 |
| Molecular Weight | 534.45 g/mol |
| Exact Mass | 534.29 |
| IUPAC Name | — |
| SMILES | [B]c1cc(CNC(=O)CCCC(=O)NCc2c(CC)nc3c(cnn3CC)c2NC2CCOCC2)ccc1F |
| InChI | InChI=1S/C28H36BFN6O3/c1-3-24-20(27(34-19-10-12-39-13-11-19)21-17-33-36(4-2)28(21)35-24)16-32-26(38)7-5-6-25(37)31-15-18-8-9-23(30)22(29)14-18/h8-9,14,17,19H,3-7,10-13,15-16H2,1-2H3,(H,31,37)(H,32,38)(H,34,35) |
| InChIKey | SRSZOLXJHIKMPM-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 110.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.45 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|