About CID 89164466
CID 89164466 (PubChem CID 89164466) has the molecular formula C32H36BClN6O3
and a molecular weight of 598.94 g/mol.
Molecular Properties
| Compound Name | CID 89164466 |
| PubChem CID | 89164466 |
| Molecular Formula | C32H36BClN6O3 |
| Molecular Weight | 598.94 g/mol |
| Exact Mass | 598.26 |
| IUPAC Name | — |
| SMILES | [B]c1cc(CNC(=O)c2cc(C)cc(C(=O)NCc3c(CC)nc4c(cnn4CC)c3NC3CCOCC3)c2)ccc1Cl |
| InChI | InChI=1S/C32H36BClN6O3/c1-4-28-24(29(38-23-8-10-43-11-9-23)25-18-37-40(5-2)30(25)39-28)17-36-32(42)22-13-19(3)12-21(15-22)31(41)35-16-20-6-7-27(34)26(33)14-20/h6-7,12-15,18,23H,4-5,8-11,16-17H2,1-3H3,(H,35,41)(H,36,42)(H,38,39) |
| InChIKey | QDAFRNVCZFEFKN-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 110.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 598.94 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 89164466 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 89164466?
The IUPAC name of CID 89164466 (CID 89164466) is not available.
What is the SMILES notation for CID 89164466?
The canonical SMILES for CID 89164466 is [B]c1cc(CNC(=O)c2cc(C)cc(C(=O)NCc3c(CC)nc4c(cnn4CC)c3NC3CCOCC3)c2)ccc1Cl.
What is the InChIKey of CID 89164466?
The InChIKey is QDAFRNVCZFEFKN-UHFFFAOYSA-N. The full InChI is InChI=1S/C32H36BClN6O3/c1-4-28-24(29(38-23-8-10-43-11-9-23)25-18-37-40(5-2)30(25)39-28)17-36-32(42)22-13-19(3)12-21(15-22)31(41)35-16-20-6-7-27(34)26(33)14-20/h6-7,12-15,18,23H,4-5,8-11,16-17H2,1-3H3,(H,35,41)(H,36,42)(H,38,39).
What are the key properties of CID 89164466?
CID 89164466 has a molecular weight of 598.94 g/mol, XLogP of 4.22, 10 rotatable bonds, 3 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for CID 89164466 is sourced from PubChem (CID 89164466), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).