C32H36BClN6O3 — CID 89164466
CID 89164466 (PubChem CID 89164466) has the molecular formula C32H36BClN6O3 and a molecular weight of 598.94 g/mol.
| Compound Name | CID 89164466 |
|---|---|
| PubChem CID | 89164466 |
| Molecular Formula | C32H36BClN6O3 |
| Molecular Weight | 598.94 g/mol |
| Exact Mass | 598.26 |
| IUPAC Name | — |
| SMILES | [B]c1cc(CNC(=O)c2cc(C)cc(C(=O)NCc3c(CC)nc4c(cnn4CC)c3NC3CCOCC3)c2)ccc1Cl |
| InChI | InChI=1S/C32H36BClN6O3/c1-4-28-24(29(38-23-8-10-43-11-9-23)25-18-37-40(5-2)30(25)39-28)17-36-32(42)22-13-19(3)12-21(15-22)31(41)35-16-20-6-7-27(34)26(33)14-20/h6-7,12-15,18,23H,4-5,8-11,16-17H2,1-3H3,(H,35,41)(H,36,42)(H,38,39) |
| InChIKey | QDAFRNVCZFEFKN-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 110.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.94 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|