C27H34BFN6O4 — CID 89164042
CID 89164042 (PubChem CID 89164042) has the molecular formula C27H34BFN6O4 and a molecular weight of 536.42 g/mol.
| Compound Name | CID 89164042 |
|---|---|
| PubChem CID | 89164042 |
| Molecular Formula | C27H34BFN6O4 |
| Molecular Weight | 536.42 g/mol |
| Exact Mass | 536.27 |
| IUPAC Name | — |
| SMILES | [B]c1cc(CNC(=O)COCC(=O)NCc2c(CC)nc3c(cnn3CC)c2NC2CCOCC2)ccc1F |
| InChI | InChI=1S/C27H34BFN6O4/c1-3-23-19(26(33-18-7-9-38-10-8-18)20-14-32-35(4-2)27(20)34-23)13-31-25(37)16-39-15-24(36)30-12-17-5-6-22(29)21(28)11-17/h5-6,11,14,18H,3-4,7-10,12-13,15-16H2,1-2H3,(H,30,36)(H,31,37)(H,33,34) |
| InChIKey | XOKPOHBXROHFMR-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 119.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.42 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|