C35H40BFN6O6 — CID 89164454
CID 89164454 (PubChem CID 89164454) has the molecular formula C35H40BFN6O6 and a molecular weight of 670.55 g/mol.
| Compound Name | CID 89164454 |
|---|---|
| PubChem CID | 89164454 |
| Molecular Formula | C35H40BFN6O6 |
| Molecular Weight | 670.55 g/mol |
| Exact Mass | 670.31 |
| IUPAC Name | — |
| SMILES | [B]c1cc(F)cc(CNC(=O)OC(C)(C)OC(=O)c2cccc(C(=O)NCc3c(CC)nc4c(cnn4CC)c3NC3CCOCC3)c2)c1 |
| InChI | InChI=1S/C35H40BFN6O6/c1-5-29-27(30(41-26-10-12-47-13-11-26)28-20-40-43(6-2)31(28)42-29)19-38-32(44)22-8-7-9-23(16-22)33(45)48-35(3,4)49-34(46)39-18-21-14-24(36)17-25(37)15-21/h7-9,14-17,20,26H,5-6,10-13,18-19H2,1-4H3,(H,38,44)(H,39,46)(H,41,42) |
| InChIKey | ZJSPRAWHXZNDBE-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 145.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 49 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 670.55 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|