C32H37BN6O4 — CID 89164411
CID 89164411 (PubChem CID 89164411) has the molecular formula C32H37BN6O4 and a molecular weight of 580.50 g/mol.
| Compound Name | CID 89164411 |
|---|---|
| PubChem CID | 89164411 |
| Molecular Formula | C32H37BN6O4 |
| Molecular Weight | 580.50 g/mol |
| Exact Mass | 580.30 |
| IUPAC Name | — |
| SMILES | [B]c1cc(CNC(=O)c2cccc(C(=O)NCc3c(CC)nc4c(cnn4CC)c3NC3CCOCC3)c2)ccc1OC |
| InChI | InChI=1S/C32H37BN6O4/c1-4-27-24(29(37-23-11-13-43-14-12-23)25-19-36-39(5-2)30(25)38-27)18-35-32(41)22-8-6-7-21(16-22)31(40)34-17-20-9-10-28(42-3)26(33)15-20/h6-10,15-16,19,23H,4-5,11-14,17-18H2,1-3H3,(H,34,40)(H,35,41)(H,37,38) |
| InChIKey | WONJYJGUHBMORK-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 119.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.50 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|