C29H37BN6O4 — CID 89164331
CID 89164331 (PubChem CID 89164331) has the molecular formula C29H37BN6O4 and a molecular weight of 544.47 g/mol.
| Compound Name | CID 89164331 |
|---|---|
| PubChem CID | 89164331 |
| Molecular Formula | C29H37BN6O4 |
| Molecular Weight | 544.47 g/mol |
| Exact Mass | 544.30 |
| IUPAC Name | — |
| SMILES | [B]c1cc(CNC(=O)C2(C(=O)NCc3c(CC)nc4c(cnn4CC)c3NC3CCOCC3)CC2)ccc1OC |
| InChI | InChI=1S/C29H37BN6O4/c1-4-23-20(25(34-19-8-12-40-13-9-19)21-17-33-36(5-2)26(21)35-23)16-32-28(38)29(10-11-29)27(37)31-15-18-6-7-24(39-3)22(30)14-18/h6-7,14,17,19H,4-5,8-13,15-16H2,1-3H3,(H,31,37)(H,32,38)(H,34,35) |
| InChIKey | LTYHMJNVQGHCBT-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 119.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.47 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|