C31H34BClN6O3 — CID 89164462
CID 89164462 (PubChem CID 89164462) has the molecular formula C31H34BClN6O3 and a molecular weight of 584.92 g/mol.
| Compound Name | CID 89164462 |
|---|---|
| PubChem CID | 89164462 |
| Molecular Formula | C31H34BClN6O3 |
| Molecular Weight | 584.92 g/mol |
| Exact Mass | 584.25 |
| IUPAC Name | — |
| SMILES | [B]c1cc(Cl)cc(CNC(=O)c2cccc(C(=O)NCc3c(CC)nc4c(cnn4CC)c3NC3CCOCC3)c2)c1 |
| InChI | InChI=1S/C31H34BClN6O3/c1-3-27-25(28(37-24-8-10-42-11-9-24)26-18-36-39(4-2)29(26)38-27)17-35-31(41)21-7-5-6-20(14-21)30(40)34-16-19-12-22(32)15-23(33)13-19/h5-7,12-15,18,24H,3-4,8-11,16-17H2,1-2H3,(H,34,40)(H,35,41)(H,37,38) |
| InChIKey | IGNCCEOMAQQKOI-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 110.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.92 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|