About CID 89164319
CID 89164319 (PubChem CID 89164319) has the molecular formula C26H32BClN6O3
and a molecular weight of 522.85 g/mol.
Molecular Properties
| Compound Name | CID 89164319 |
| PubChem CID | 89164319 |
| Molecular Formula | C26H32BClN6O3 |
| Molecular Weight | 522.85 g/mol |
| Exact Mass | 522.23 |
| IUPAC Name | — |
| SMILES | [B]c1cc(CNC(=O)CC(=O)NCc2c(CC)nc3c(cnn3CC)c2NC2CCOCC2)ccc1Cl |
| InChI | InChI=1S/C26H32BClN6O3/c1-3-22-18(14-30-24(36)12-23(35)29-13-16-5-6-21(28)20(27)11-16)25(32-17-7-9-37-10-8-17)19-15-31-34(4-2)26(19)33-22/h5-6,11,15,17H,3-4,7-10,12-14H2,1-2H3,(H,29,35)(H,30,36)(H,32,33) |
| InChIKey | OYRKIXZZAXKJDB-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 110.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 522.85 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 89164319 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 89164319?
The IUPAC name of CID 89164319 (CID 89164319) is not available.
What is the SMILES notation for CID 89164319?
The canonical SMILES for CID 89164319 is [B]c1cc(CNC(=O)CC(=O)NCc2c(CC)nc3c(cnn3CC)c2NC2CCOCC2)ccc1Cl.
What is the InChIKey of CID 89164319?
The InChIKey is OYRKIXZZAXKJDB-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H32BClN6O3/c1-3-22-18(14-30-24(36)12-23(35)29-13-16-5-6-21(28)20(27)11-16)25(32-17-7-9-37-10-8-17)19-15-31-34(4-2)26(19)33-22/h5-6,11,15,17H,3-4,7-10,12-14H2,1-2H3,(H,29,35)(H,30,36)(H,32,33).
What are the key properties of CID 89164319?
CID 89164319 has a molecular weight of 522.85 g/mol, XLogP of 2.37, 10 rotatable bonds, 3 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for CID 89164319 is sourced from PubChem (CID 89164319), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).