C26H32BClN6O3 — CID 89164319
CID 89164319 (PubChem CID 89164319) has the molecular formula C26H32BClN6O3 and a molecular weight of 522.85 g/mol.
| Compound Name | CID 89164319 |
|---|---|
| PubChem CID | 89164319 |
| Molecular Formula | C26H32BClN6O3 |
| Molecular Weight | 522.85 g/mol |
| Exact Mass | 522.23 |
| IUPAC Name | — |
| SMILES | [B]c1cc(CNC(=O)CC(=O)NCc2c(CC)nc3c(cnn3CC)c2NC2CCOCC2)ccc1Cl |
| InChI | InChI=1S/C26H32BClN6O3/c1-3-22-18(14-30-24(36)12-23(35)29-13-16-5-6-21(28)20(27)11-16)25(32-17-7-9-37-10-8-17)19-15-31-34(4-2)26(19)33-22/h5-6,11,15,17H,3-4,7-10,12-14H2,1-2H3,(H,29,35)(H,30,36)(H,32,33) |
| InChIKey | OYRKIXZZAXKJDB-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 110.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.85 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|