C22H14F4N2O2S — CID 58025612
[5-(4-fluorophenyl)-2-(2-methoxy-3-pyridinyl)-2H-1,3-thiazol-3-yl]-(2,4,5-trifluorophenyl)methanone (PubChem CID 58025612) has the molecular formula C22H14F4N2O2S and a molecular weight of 446.43 g/mol. Its IUPAC name is [5-(4-fluorophenyl)-2-(2-methoxy-3-pyridinyl)-2H-1,3-thiazol-3-yl]-(2,4,5-trifluorophenyl)methanone.
| Compound Name | [5-(4-fluorophenyl)-2-(2-methoxy-3-pyridinyl)-2H-1,3-thiazol-3-yl]-(2,4,5-trifluorophenyl)methanone |
|---|---|
| PubChem CID | 58025612 |
| Molecular Formula | C22H14F4N2O2S |
| Molecular Weight | 446.43 g/mol |
| Exact Mass | 446.07 |
| IUPAC Name | [5-(4-fluorophenyl)-2-(2-methoxy-3-pyridinyl)-2H-1,3-thiazol-3-yl]-(2,4,5-trifluorophenyl)methanone |
| SMILES | COc1ncccc1C1SC(c2ccc(F)cc2)=CN1C(=O)c1cc(F)c(F)cc1F |
| InChI | InChI=1S/C22H14F4N2O2S/c1-30-20-14(3-2-8-27-20)22-28(11-19(31-22)12-4-6-13(23)7-5-12)21(29)15-9-17(25)18(26)10-16(15)24/h2-11,22H,1H3 |
| InChIKey | DNOMVAOWUVWHAX-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.43 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|