C26H23FO2 — CID 58025782
(3-fluorophenyl)-[5-(2-methoxyphenyl)-3-(4-methylphenyl)cyclopent-2-en-1-yl]methanone (PubChem CID 58025782) has the molecular formula C26H23FO2 and a molecular weight of 386.47 g/mol. Its IUPAC name is (3-fluorophenyl)-[5-(2-methoxyphenyl)-3-(4-methylphenyl)cyclopent-2-en-1-yl]methanone.
| Compound Name | (3-fluorophenyl)-[5-(2-methoxyphenyl)-3-(4-methylphenyl)cyclopent-2-en-1-yl]methanone |
|---|---|
| PubChem CID | 58025782 |
| Molecular Formula | C26H23FO2 |
| Molecular Weight | 386.47 g/mol |
| Exact Mass | 386.17 |
| IUPAC Name | (3-fluorophenyl)-[5-(2-methoxyphenyl)-3-(4-methylphenyl)cyclopent-2-en-1-yl]methanone |
| SMILES | COc1ccccc1C1CC(c2ccc(C)cc2)=CC1C(=O)c1cccc(F)c1 |
| InChI | InChI=1S/C26H23FO2/c1-17-10-12-18(13-11-17)20-15-23(22-8-3-4-9-25(22)29-2)24(16-20)26(28)19-6-5-7-21(27)14-19/h3-14,16,23-24H,15H2,1-2H3 |
| InChIKey | CJLVIZUXNUFDMA-UHFFFAOYSA-N |
| XLogP | 6.21 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.47 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |