C23H23N3O2S — CID 58031677
1-benzyl-3-[4-methyl-5-(3-pyridin-3-ylpropanoyl)thiophen-2-yl]imidazolidin-2-one (PubChem CID 58031677) has the molecular formula C23H23N3O2S and a molecular weight of 405.52 g/mol. Its IUPAC name is 1-benzyl-3-[4-methyl-5-(3-pyridin-3-ylpropanoyl)thiophen-2-yl]imidazolidin-2-one.
| Compound Name | 1-benzyl-3-[4-methyl-5-(3-pyridin-3-ylpropanoyl)thiophen-2-yl]imidazolidin-2-one |
|---|---|
| PubChem CID | 58031677 |
| Molecular Formula | C23H23N3O2S |
| Molecular Weight | 405.52 g/mol |
| Exact Mass | 405.15 |
| IUPAC Name | 1-benzyl-3-[4-methyl-5-(3-pyridin-3-ylpropanoyl)thiophen-2-yl]imidazolidin-2-one |
| SMILES | Cc1cc(N2CCN(Cc3ccccc3)C2=O)sc1C(=O)CCc1cccnc1 |
| InChI | InChI=1S/C23H23N3O2S/c1-17-14-21(29-22(17)20(27)10-9-18-8-5-11-24-15-18)26-13-12-25(23(26)28)16-19-6-3-2-4-7-19/h2-8,11,14-15H,9-10,12-13,16H2,1H3 |
| InChIKey | YEURXWKXLDASTN-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 53.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.52 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |