C19H22N4O2S — CID 58051068
1-but-3-enyl-3-[4-methyl-5-(3-pyridin-3-ylpropanoyl)-1,3-thiazol-2-yl]imidazolidin-2-one (PubChem CID 58051068) has the molecular formula C19H22N4O2S and a molecular weight of 370.48 g/mol. Its IUPAC name is 1-but-3-enyl-3-[4-methyl-5-(3-pyridin-3-ylpropanoyl)-1,3-thiazol-2-yl]imidazolidin-2-one.
| Compound Name | 1-but-3-enyl-3-[4-methyl-5-(3-pyridin-3-ylpropanoyl)-1,3-thiazol-2-yl]imidazolidin-2-one |
|---|---|
| PubChem CID | 58051068 |
| Molecular Formula | C19H22N4O2S |
| Molecular Weight | 370.48 g/mol |
| Exact Mass | 370.15 |
| IUPAC Name | 1-but-3-enyl-3-[4-methyl-5-(3-pyridin-3-ylpropanoyl)-1,3-thiazol-2-yl]imidazolidin-2-one |
| SMILES | C=CCCN1CCN(c2nc(C)c(C(=O)CCc3cccnc3)s2)C1=O |
| InChI | InChI=1S/C19H22N4O2S/c1-3-4-10-22-11-12-23(19(22)25)18-21-14(2)17(26-18)16(24)8-7-15-6-5-9-20-13-15/h3,5-6,9,13H,1,4,7-8,10-12H2,2H3 |
| InChIKey | VFBKYSHRSDQBEO-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 66.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.48 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|