C30H22F2N4O4 — CID 58032380
[2-[3-fluoro-4-[5-(4-methylphenyl)-1,2,4-oxadiazol-3-yl]phenyl]-1-[[5-(4-fluorophenyl)pyridine-3-carbonyl]amino]ethyl] formate (PubChem CID 58032380) has the molecular formula C30H22F2N4O4 and a molecular weight of 540.53 g/mol. Its IUPAC name is [2-[3-fluoro-4-[5-(4-methylphenyl)-1,2,4-oxadiazol-3-yl]phenyl]-1-[[5-(4-fluorophenyl)pyridine-3-carbonyl]amino]ethyl] formate.
| Compound Name | [2-[3-fluoro-4-[5-(4-methylphenyl)-1,2,4-oxadiazol-3-yl]phenyl]-1-[[5-(4-fluorophenyl)pyridine-3-carbonyl]amino]ethyl] formate |
|---|---|
| PubChem CID | 58032380 |
| Molecular Formula | C30H22F2N4O4 |
| Molecular Weight | 540.53 g/mol |
| Exact Mass | 540.16 |
| IUPAC Name | [2-[3-fluoro-4-[5-(4-methylphenyl)-1,2,4-oxadiazol-3-yl]phenyl]-1-[[5-(4-fluorophenyl)pyridine-3-carbonyl]amino]ethyl] formate |
| SMILES | Cc1ccc(-c2nc(-c3ccc(CC(NC(=O)c4cncc(-c5ccc(F)cc5)c4)OC=O)cc3F)no2)cc1 |
| InChI | InChI=1S/C30H22F2N4O4/c1-18-2-5-21(6-3-18)30-35-28(36-40-30)25-11-4-19(12-26(25)32)13-27(39-17-37)34-29(38)23-14-22(15-33-16-23)20-7-9-24(31)10-8-20/h2-12,14-17,27H,13H2,1H3,(H,34,38) |
| InChIKey | XGXABECXXYMUSF-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 107.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.53 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|