C31H23F2NO4S — CID 58032310
[2-[3-fluoro-4-[5-(4-methylphenyl)thiophen-2-yl]phenyl]-1-[[5-(4-fluorophenyl)furan-2-carbonyl]amino]ethyl] formate (PubChem CID 58032310) has the molecular formula C31H23F2NO4S and a molecular weight of 543.59 g/mol. Its IUPAC name is [2-[3-fluoro-4-[5-(4-methylphenyl)thiophen-2-yl]phenyl]-1-[[5-(4-fluorophenyl)furan-2-carbonyl]amino]ethyl] formate.
| Compound Name | [2-[3-fluoro-4-[5-(4-methylphenyl)thiophen-2-yl]phenyl]-1-[[5-(4-fluorophenyl)furan-2-carbonyl]amino]ethyl] formate |
|---|---|
| PubChem CID | 58032310 |
| Molecular Formula | C31H23F2NO4S |
| Molecular Weight | 543.59 g/mol |
| Exact Mass | 543.13 |
| IUPAC Name | [2-[3-fluoro-4-[5-(4-methylphenyl)thiophen-2-yl]phenyl]-1-[[5-(4-fluorophenyl)furan-2-carbonyl]amino]ethyl] formate |
| SMILES | Cc1ccc(-c2ccc(-c3ccc(CC(NC(=O)c4ccc(-c5ccc(F)cc5)o4)OC=O)cc3F)s2)cc1 |
| InChI | InChI=1S/C31H23F2NO4S/c1-19-2-5-22(6-3-19)28-14-15-29(39-28)24-11-4-20(16-25(24)33)17-30(37-18-35)34-31(36)27-13-12-26(38-27)21-7-9-23(32)10-8-21/h2-16,18,30H,17H2,1H3,(H,34,36) |
| InChIKey | YYQRXLYQHREEQT-UHFFFAOYSA-N |
| XLogP | 7.40 |
| TPSA | 68.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.59 |
| LogP ≤ 5 | 7.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|