C21H16F2INO4 — CID 66630459
methyl 3-(3-fluoro-4-iodophenyl)-2-[[5-(4-fluorophenyl)furan-2-carbonyl]amino]propanoate (PubChem CID 66630459) has the molecular formula C21H16F2INO4 and a molecular weight of 511.26 g/mol. Its IUPAC name is methyl 3-(3-fluoro-4-iodophenyl)-2-[[5-(4-fluorophenyl)furan-2-carbonyl]amino]propanoate.
| Compound Name | methyl 3-(3-fluoro-4-iodophenyl)-2-[[5-(4-fluorophenyl)furan-2-carbonyl]amino]propanoate |
|---|---|
| PubChem CID | 66630459 |
| Molecular Formula | C21H16F2INO4 |
| Molecular Weight | 511.26 g/mol |
| Exact Mass | 511.01 |
| IUPAC Name | methyl 3-(3-fluoro-4-iodophenyl)-2-[[5-(4-fluorophenyl)furan-2-carbonyl]amino]propanoate |
| SMILES | COC(=O)C(Cc1ccc(I)c(F)c1)NC(=O)c1ccc(-c2ccc(F)cc2)o1 |
| InChI | InChI=1S/C21H16F2INO4/c1-28-21(27)17(11-12-2-7-16(24)15(23)10-12)25-20(26)19-9-8-18(29-19)13-3-5-14(22)6-4-13/h2-10,17H,11H2,1H3,(H,25,26) |
| InChIKey | ZIWGNCLZZBKWGN-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 68.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.26 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|