C26H27NO6S — CID 58033305
[2-(hydroxymethyl)-3,10-dimethoxy-6,8,13,13a-tetrahydro-5H-isoquinolino[2,1-b]isoquinolin-9-yl] benzenesulfonate (PubChem CID 58033305) has the molecular formula C26H27NO6S and a molecular weight of 481.57 g/mol. Its IUPAC name is [2-(hydroxymethyl)-3,10-dimethoxy-6,8,13,13a-tetrahydro-5H-isoquinolino[2,1-b]isoquinolin-9-yl] benzenesulfonate.
| Compound Name | [2-(hydroxymethyl)-3,10-dimethoxy-6,8,13,13a-tetrahydro-5H-isoquinolino[2,1-b]isoquinolin-9-yl] benzenesulfonate |
|---|---|
| PubChem CID | 58033305 |
| Molecular Formula | C26H27NO6S |
| Molecular Weight | 481.57 g/mol |
| Exact Mass | 481.16 |
| IUPAC Name | [2-(hydroxymethyl)-3,10-dimethoxy-6,8,13,13a-tetrahydro-5H-isoquinolino[2,1-b]isoquinolin-9-yl] benzenesulfonate |
| SMILES | COc1cc2c(cc1CO)C1Cc3ccc(OC)c(OS(=O)(=O)c4ccccc4)c3CN1CC2 |
| InChI | InChI=1S/C26H27NO6S/c1-31-24-9-8-17-13-23-21-12-19(16-28)25(32-2)14-18(21)10-11-27(23)15-22(17)26(24)33-34(29,30)20-6-4-3-5-7-20/h3-9,12,14,23,28H,10-11,13,15-16H2,1-2H3 |
| InChIKey | LLLJDTDQHRLRRN-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 85.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.57 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|