C13H14N2 — CID 58034287
5,13-diazatetracyclo[9.3.1.02,10.04,8]pentadeca-2(10),3,5,8-tetraene (PubChem CID 58034287) has the molecular formula C13H14N2 and a molecular weight of 198.27 g/mol. Its IUPAC name is 5,13-diazatetracyclo[9.3.1.02,10.04,8]pentadeca-2(10),3,5,8-tetraene.
| Compound Name | 5,13-diazatetracyclo[9.3.1.02,10.04,8]pentadeca-2(10),3,5,8-tetraene |
|---|---|
| PubChem CID | 58034287 |
| Molecular Formula | C13H14N2 |
| Molecular Weight | 198.27 g/mol |
| Exact Mass | 198.12 |
| IUPAC Name | 5,13-diazatetracyclo[9.3.1.02,10.04,8]pentadeca-2(10),3,5,8-tetraene |
| SMILES | C1=Nc2cc3c(cc2C1)C1CNCC3C1 |
| InChI | InChI=1S/C13H14N2/c1-2-15-13-5-12-10-3-9(6-14-7-10)11(12)4-8(1)13/h2,4-5,9-10,14H,1,3,6-7H2 |
| InChIKey | LYXNGKOYBQXUNL-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.27 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |