C27H21NO3 — CID 58034441
2-[3-hydroxy-3-methyl-1-[4-(2-phenylethynyl)phenyl]cyclobutyl]isoindole-1,3-dione (PubChem CID 58034441) has the molecular formula C27H21NO3 and a molecular weight of 407.47 g/mol. Its IUPAC name is 2-[3-hydroxy-3-methyl-1-[4-(2-phenylethynyl)phenyl]cyclobutyl]isoindole-1,3-dione.
| Compound Name | 2-[3-hydroxy-3-methyl-1-[4-(2-phenylethynyl)phenyl]cyclobutyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 58034441 |
| Molecular Formula | C27H21NO3 |
| Molecular Weight | 407.47 g/mol |
| Exact Mass | 407.15 |
| IUPAC Name | 2-[3-hydroxy-3-methyl-1-[4-(2-phenylethynyl)phenyl]cyclobutyl]isoindole-1,3-dione |
| SMILES | CC1(O)CC(c2ccc(C#Cc3ccccc3)cc2)(N2C(=O)c3ccccc3C2=O)C1 |
| InChI | InChI=1S/C27H21NO3/c1-26(31)17-27(18-26,28-24(29)22-9-5-6-10-23(22)25(28)30)21-15-13-20(14-16-21)12-11-19-7-3-2-4-8-19/h2-10,13-16,31H,17-18H2,1H3 |
| InChIKey | UYPTYRVITCQNAQ-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.47 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|