C20H29N4O4+ — CID 58036081
methyl 5-[4-[2-(3,5,7-triaza-1-azoniatricyclo[3.3.1.13,7]decan-1-yl)acetyl]phenoxy]pentanoate (PubChem CID 58036081) has the molecular formula C20H29N4O4+ and a molecular weight of 389.48 g/mol. Its IUPAC name is methyl 5-[4-[2-(3,5,7-triaza-1-azoniatricyclo[3.3.1.13,7]decan-1-yl)acetyl]phenoxy]pentanoate.
| Compound Name | methyl 5-[4-[2-(3,5,7-triaza-1-azoniatricyclo[3.3.1.13,7]decan-1-yl)acetyl]phenoxy]pentanoate |
|---|---|
| PubChem CID | 58036081 |
| Molecular Formula | C20H29N4O4+ |
| Molecular Weight | 389.48 g/mol |
| Exact Mass | 389.22 |
| IUPAC Name | methyl 5-[4-[2-(3,5,7-triaza-1-azoniatricyclo[3.3.1.13,7]decan-1-yl)acetyl]phenoxy]pentanoate |
| SMILES | COC(=O)CCCCOc1ccc(C(=O)C[N+]23CN4CN(CN(C4)C2)C3)cc1 |
| InChI | InChI=1S/C20H29N4O4/c1-27-20(26)4-2-3-9-28-18-7-5-17(6-8-18)19(25)10-24-14-21-11-22(15-24)13-23(12-21)16-24/h5-8H,2-4,9-16H2,1H3/q+1 |
| InChIKey | KABXIHWBIXYINJ-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 62.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.48 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|