C32H34B2N4O6+2 — CID 58038900
CID 58038900 (PubChem CID 58038900) has the molecular formula C32H34B2N4O6+2 and a molecular weight of 592.27 g/mol.
| Compound Name | CID 58038900 |
|---|---|
| PubChem CID | 58038900 |
| Molecular Formula | C32H34B2N4O6+2 |
| Molecular Weight | 592.27 g/mol |
| Exact Mass | 592.27 |
| IUPAC Name | — |
| SMILES | C=C(C)C(=O)NCCCNC(=O)c1cc(-c2cc[n+](Cc3ccccc3O[B]O)cc2)c[n+](Cc2ccccc2O[B]O)c1 |
| InChI | InChI=1S/C32H32B2N4O6/c1-23(2)31(39)35-14-7-15-36-32(40)28-18-27(21-38(22-28)20-26-9-4-6-11-30(26)44-34-42)24-12-16-37(17-13-24)19-25-8-3-5-10-29(25)43-33-41/h3-6,8-13,16-18,21-22,41-42H,1,7,14-15,19-20H2,2H3/p+2 |
| InChIKey | WOBLBHFJTVUKPM-UHFFFAOYSA-P |
| XLogP | 1.65 |
| TPSA | 124.88 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.27 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|