C24H25F6N5O4S — CID 58040208
3,5-dimethyl-4-[4-[[4-(2,2,2-trifluoroethoxy)-6-[[3-(trifluoromethyl)phenyl]methyl]-1,3,5-triazin-2-yl]methyl]piperidin-1-yl]sulfonyl-1,2-oxazole (PubChem CID 58040208) has the molecular formula C24H25F6N5O4S and a molecular weight of 593.55 g/mol. Its IUPAC name is 3,5-dimethyl-4-[4-[[4-(2,2,2-trifluoroethoxy)-6-[[3-(trifluoromethyl)phenyl]methyl]-1,3,5-triazin-2-yl]methyl]piperidin-1-yl]sulfonyl-1,2-oxazole.
| Compound Name | 3,5-dimethyl-4-[4-[[4-(2,2,2-trifluoroethoxy)-6-[[3-(trifluoromethyl)phenyl]methyl]-1,3,5-triazin-2-yl]methyl]piperidin-1-yl]sulfonyl-1,2-oxazole |
|---|---|
| PubChem CID | 58040208 |
| Molecular Formula | C24H25F6N5O4S |
| Molecular Weight | 593.55 g/mol |
| Exact Mass | 593.15 |
| IUPAC Name | 3,5-dimethyl-4-[4-[[4-(2,2,2-trifluoroethoxy)-6-[[3-(trifluoromethyl)phenyl]methyl]-1,3,5-triazin-2-yl]methyl]piperidin-1-yl]sulfonyl-1,2-oxazole |
| SMILES | Cc1noc(C)c1S(=O)(=O)N1CCC(Cc2nc(Cc3cccc(C(F)(F)F)c3)nc(OCC(F)(F)F)n2)CC1 |
| InChI | InChI=1S/C24H25F6N5O4S/c1-14-21(15(2)39-34-14)40(36,37)35-8-6-16(7-9-35)11-19-31-20(33-22(32-19)38-13-23(25,26)27)12-17-4-3-5-18(10-17)24(28,29)30/h3-5,10,16H,6-9,11-13H2,1-2H3 |
| InChIKey | HIRRQRCHVXRYLY-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 111.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.55 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |