C18H36N2O3 — CID 58040518
1-[2-(2-hydroxyethylamino)ethyl-(3-oxoheptyl)amino]heptan-3-one (PubChem CID 58040518) has the molecular formula C18H36N2O3 and a molecular weight of 328.50 g/mol. Its IUPAC name is 1-[2-(2-hydroxyethylamino)ethyl-(3-oxoheptyl)amino]heptan-3-one.
| Compound Name | 1-[2-(2-hydroxyethylamino)ethyl-(3-oxoheptyl)amino]heptan-3-one |
|---|---|
| PubChem CID | 58040518 |
| Molecular Formula | C18H36N2O3 |
| Molecular Weight | 328.50 g/mol |
| Exact Mass | 328.27 |
| IUPAC Name | 1-[2-(2-hydroxyethylamino)ethyl-(3-oxoheptyl)amino]heptan-3-one |
| SMILES | CCCCC(=O)CCN(CCNCCO)CCC(=O)CCCC |
| InChI | InChI=1S/C18H36N2O3/c1-3-5-7-17(22)9-13-20(15-11-19-12-16-21)14-10-18(23)8-6-4-2/h19,21H,3-16H2,1-2H3 |
| InChIKey | SHICNCUYFZQCEW-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.50 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|