C25H50N2NaO3 — CID 146586315
CID 146586315 (PubChem CID 146586315) has the molecular formula C25H50N2NaO3 and a molecular weight of 449.68 g/mol.
| Compound Name | CID 146586315 |
|---|---|
| PubChem CID | 146586315 |
| Molecular Formula | C25H50N2NaO3 |
| Molecular Weight | 449.68 g/mol |
| Exact Mass | 449.37 |
| IUPAC Name | — |
| SMILES | CCCCCCCC/C=C\CCCCCCCCNCCN(CCO)CCC(=O)O.[Na] |
| InChI | InChI=1S/C25H50N2O3.Na/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-19-26-20-22-27(23-24-28)21-18-25(29)30;/h9-10,26,28H,2-8,11-24H2,1H3,(H,29,30);/b10-9-; |
| InChIKey | DCBOIXOIZVFLQB-KVVVOXFISA-N |
| XLogP | 5.00 |
| TPSA | 72.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.68 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|