C13H30N2O5 — CID 174675948
2-[bis(2-hydroxyethyl)amino]ethanol;2-(pentylamino)acetic acid (PubChem CID 174675948) has the molecular formula C13H30N2O5 and a molecular weight of 294.39 g/mol. Its IUPAC name is 2-[bis(2-hydroxyethyl)amino]ethanol;2-(pentylamino)acetic acid.
| Compound Name | 2-[bis(2-hydroxyethyl)amino]ethanol;2-(pentylamino)acetic acid |
|---|---|
| PubChem CID | 174675948 |
| Molecular Formula | C13H30N2O5 |
| Molecular Weight | 294.39 g/mol |
| Exact Mass | 294.22 |
| IUPAC Name | 2-[bis(2-hydroxyethyl)amino]ethanol;2-(pentylamino)acetic acid |
| SMILES | CCCCCNCC(=O)O.OCCN(CCO)CCO |
| InChI | InChI=1S/C7H15NO2.C6H15NO3/c1-2-3-4-5-8-6-7(9)10;8-4-1-7(2-5-9)3-6-10/h8H,2-6H2,1H3,(H,9,10);8-10H,1-6H2 |
| InChIKey | RNSNIZQBOOOHDM-UHFFFAOYSA-N |
| XLogP | -0.88 |
| TPSA | 113.26 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.39 |
| LogP ≤ 5 | -0.88 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|