C21H42N4O4 — CID 58040582
propyl 3-[3-[bis[3-oxo-3-(propylamino)propyl]amino]propylamino]propanoate (PubChem CID 58040582) has the molecular formula C21H42N4O4 and a molecular weight of 414.59 g/mol. Its IUPAC name is propyl 3-[3-[bis[3-oxo-3-(propylamino)propyl]amino]propylamino]propanoate.
| Compound Name | propyl 3-[3-[bis[3-oxo-3-(propylamino)propyl]amino]propylamino]propanoate |
|---|---|
| PubChem CID | 58040582 |
| Molecular Formula | C21H42N4O4 |
| Molecular Weight | 414.59 g/mol |
| Exact Mass | 414.32 |
| IUPAC Name | propyl 3-[3-[bis[3-oxo-3-(propylamino)propyl]amino]propylamino]propanoate |
| SMILES | CCCNC(=O)CCN(CCCNCCC(=O)OCCC)CCC(=O)NCCC |
| InChI | InChI=1S/C21H42N4O4/c1-4-11-23-19(26)9-16-25(17-10-20(27)24-12-5-2)15-7-13-22-14-8-21(28)29-18-6-3/h22H,4-18H2,1-3H3,(H,23,26)(H,24,27) |
| InChIKey | QWTKYZRYAIBBOI-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 99.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.59 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|